C16H14ClNO3 — CID 7514858
[2-[(3-chlorophenyl)methylamino]-2-oxoethyl] benzoate (PubChem CID 7514858) has the molecular formula C16H14ClNO3 and a molecular weight of 303.75 g/mol. Its IUPAC name is [2-[(3-chlorophenyl)methylamino]-2-oxoethyl] benzoate.
| Compound Name | [2-[(3-chlorophenyl)methylamino]-2-oxoethyl] benzoate |
|---|---|
| PubChem CID | 7514858 |
| Molecular Formula | C16H14ClNO3 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | [2-[(3-chlorophenyl)methylamino]-2-oxoethyl] benzoate |
| SMILES | O=C(COC(=O)c1ccccc1)NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H14ClNO3/c17-14-8-4-5-12(9-14)10-18-15(19)11-21-16(20)13-6-2-1-3-7-13/h1-9H,10-11H2,(H,18,19) |
| InChIKey | JEDKZOAOXSIEKC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |