C22H26ClNO6 — CID 50929498
[2-[(3-chlorophenyl)methylamino]-2-oxoethyl] 3,4,5-triethoxybenzoate (PubChem CID 50929498) has the molecular formula C22H26ClNO6 and a molecular weight of 435.90 g/mol. Its IUPAC name is [2-[(3-chlorophenyl)methylamino]-2-oxoethyl] 3,4,5-triethoxybenzoate.
| Compound Name | [2-[(3-chlorophenyl)methylamino]-2-oxoethyl] 3,4,5-triethoxybenzoate |
|---|---|
| PubChem CID | 50929498 |
| Molecular Formula | C22H26ClNO6 |
| Molecular Weight | 435.90 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | [2-[(3-chlorophenyl)methylamino]-2-oxoethyl] 3,4,5-triethoxybenzoate |
| SMILES | CCOc1cc(C(=O)OCC(=O)NCc2cccc(Cl)c2)cc(OCC)c1OCC |
| InChI | InChI=1S/C22H26ClNO6/c1-4-27-18-11-16(12-19(28-5-2)21(18)29-6-3)22(26)30-14-20(25)24-13-15-8-7-9-17(23)10-15/h7-12H,4-6,13-14H2,1-3H3,(H,24,25) |
| InChIKey | HDZKXZPEEWAZBY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.90 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |