C15H16ClNO5 — CID 7851537
4-O-[2-[(3-chlorophenyl)methylamino]-2-oxoethyl] 1-O-ethyl (E)-but-2-enedioate (PubChem CID 7851537) has the molecular formula C15H16ClNO5 and a molecular weight of 325.75 g/mol. Its IUPAC name is 4-O-[2-[(3-chlorophenyl)methylamino]-2-oxoethyl] 1-O-ethyl (E)-but-2-enedioate.
| Compound Name | 4-O-[2-[(3-chlorophenyl)methylamino]-2-oxoethyl] 1-O-ethyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 7851537 |
| Molecular Formula | C15H16ClNO5 |
| Molecular Weight | 325.75 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 4-O-[2-[(3-chlorophenyl)methylamino]-2-oxoethyl] 1-O-ethyl (E)-but-2-enedioate |
| SMILES | CCOC(=O)/C=C/C(=O)OCC(=O)NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H16ClNO5/c1-2-21-14(19)6-7-15(20)22-10-13(18)17-9-11-4-3-5-12(16)8-11/h3-8H,2,9-10H2,1H3,(H,17,18)/b7-6+ |
| InChIKey | SFTNFKGQHWDPBZ-VOTSOKGWSA-N |
| XLogP | 1.62 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.75 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|