C10H12ClNO — CID 17071125
N-[(3-chlorophenyl)methyl]propanamide (PubChem CID 17071125) has the molecular formula C10H12ClNO and a molecular weight of 197.67 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]propanamide.
| Compound Name | N-[(3-chlorophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 17071125 |
| Molecular Formula | C10H12ClNO |
| Molecular Weight | 197.67 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]propanamide |
| SMILES | CCC(=O)NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C10H12ClNO/c1-2-10(13)12-7-8-4-3-5-9(11)6-8/h3-6H,2,7H2,1H3,(H,12,13) |
| InChIKey | YSSQDJGNEOEMHI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.67 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |