C11H13Cl2NO — CID 17071148
4-chloro-N-[(3-chlorophenyl)methyl]butanamide (PubChem CID 17071148) has the molecular formula C11H13Cl2NO and a molecular weight of 246.14 g/mol. Its IUPAC name is 4-chloro-N-[(3-chlorophenyl)methyl]butanamide.
| Compound Name | 4-chloro-N-[(3-chlorophenyl)methyl]butanamide |
|---|---|
| PubChem CID | 17071148 |
| Molecular Formula | C11H13Cl2NO |
| Molecular Weight | 246.14 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 4-chloro-N-[(3-chlorophenyl)methyl]butanamide |
| SMILES | O=C(CCCCl)NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C11H13Cl2NO/c12-6-2-5-11(15)14-8-9-3-1-4-10(13)7-9/h1,3-4,7H,2,5-6,8H2,(H,14,15) |
| InChIKey | RLXXGLLDJAGYCF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.14 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|