C11H18N2O2V — CID 25061500
N-[[3-(aminomethyl)phenyl]methyl]propanamide;vanadium;hydrate (PubChem CID 25061500) has the molecular formula C11H18N2O2V and a molecular weight of 261.22 g/mol. Its IUPAC name is N-[[3-(aminomethyl)phenyl]methyl]propanamide;vanadium;hydrate.
| Compound Name | N-[[3-(aminomethyl)phenyl]methyl]propanamide;vanadium;hydrate |
|---|---|
| PubChem CID | 25061500 |
| Molecular Formula | C11H18N2O2V |
| Molecular Weight | 261.22 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | N-[[3-(aminomethyl)phenyl]methyl]propanamide;vanadium;hydrate |
| SMILES | CCC(=O)NCc1cccc(CN)c1.O.[V] |
| InChI | InChI=1S/C11H16N2O.H2O.V/c1-2-11(14)13-8-10-5-3-4-9(6-10)7-12;;/h3-6H,2,7-8,12H2,1H3,(H,13,14);1H2; |
| InChIKey | FLZDNOCYDYBRMA-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 86.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.22 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |