About N-[[3-(aminomethyl)phenyl]methyl]benzamide;vanadium;hydroxide;hydrate
N-[[3-(aminomethyl)phenyl]methyl]benzamide;vanadium;hydroxide;hydrate (PubChem CID 25062030) has the molecular formula C15H19N2O3V-
and a molecular weight of 326.27 g/mol. Its IUPAC name is N-[[3-(aminomethyl)phenyl]methyl]benzamide;vanadium;hydroxide;hydrate.
Molecular Properties
| Compound Name | N-[[3-(aminomethyl)phenyl]methyl]benzamide;vanadium;hydroxide;hydrate |
| PubChem CID | 25062030 |
| Molecular Formula | C15H19N2O3V- |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | N-[[3-(aminomethyl)phenyl]methyl]benzamide;vanadium;hydroxide;hydrate |
| SMILES | NCc1cccc(CNC(=O)c2ccccc2)c1.O.[OH-].[V] |
| InChI | InChI=1S/C15H16N2O.2H2O.V/c16-10-12-5-4-6-13(9-12)11-17-15(18)14-7-2-1-3-8-14;;;/h1-9H,10-11,16H2,(H,17,18);2*1H2;/p-1 |
| InChIKey | IIERUMHLJYSVNK-UHFFFAOYSA-M |
| XLogP | 1.07 |
| TPSA | 116.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[3-(aminomethyl)phenyl]methyl]benzamide;vanadium;hydroxide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3-(aminomethyl)phenyl]methyl]benzamide;vanadium;hydroxide;hydrate?
The IUPAC name of N-[[3-(aminomethyl)phenyl]methyl]benzamide;vanadium;hydroxide;hydrate (CID 25062030) is N-[[3-(aminomethyl)phenyl]methyl]benzamide;vanadium;hydroxide;hydrate.
What is the SMILES notation for N-[[3-(aminomethyl)phenyl]methyl]benzamide;vanadium;hydroxide;hydrate?
The canonical SMILES for N-[[3-(aminomethyl)phenyl]methyl]benzamide;vanadium;hydroxide;hydrate is NCc1cccc(CNC(=O)c2ccccc2)c1.O.[OH-].[V].
What is the InChIKey of N-[[3-(aminomethyl)phenyl]methyl]benzamide;vanadium;hydroxide;hydrate?
The InChIKey is IIERUMHLJYSVNK-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H16N2O.2H2O.V/c16-10-12-5-4-6-13(9-12)11-17-15(18)14-7-2-1-3-8-14;;;/h1-9H,10-11,16H2,(H,17,18);2*1H2;/p-1.
What are the key properties of N-[[3-(aminomethyl)phenyl]methyl]benzamide;vanadium;hydroxide;hydrate?
N-[[3-(aminomethyl)phenyl]methyl]benzamide;vanadium;hydroxide;hydrate has a molecular weight of 326.27 g/mol, XLogP of 1.07, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3-(aminomethyl)phenyl]methyl]benzamide;vanadium;hydroxide;hydrate is sourced from PubChem (CID 25062030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).