C20H24N8O2 — CID 59153726
3-N,6-N-bis[[3-(aminomethyl)phenyl]methyl]-1,4-dihydro-1,2,4,5-tetrazine-3,6-dicarboxamide (PubChem CID 59153726) has the molecular formula C20H24N8O2 and a molecular weight of 408.47 g/mol. Its IUPAC name is 3-N,6-N-bis[[3-(aminomethyl)phenyl]methyl]-1,4-dihydro-1,2,4,5-tetrazine-3,6-dicarboxamide.
| Compound Name | 3-N,6-N-bis[[3-(aminomethyl)phenyl]methyl]-1,4-dihydro-1,2,4,5-tetrazine-3,6-dicarboxamide |
|---|---|
| PubChem CID | 59153726 |
| Molecular Formula | C20H24N8O2 |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 3-N,6-N-bis[[3-(aminomethyl)phenyl]methyl]-1,4-dihydro-1,2,4,5-tetrazine-3,6-dicarboxamide |
| SMILES | NCc1cccc(CNC(=O)C2=NNC(C(=O)NCc3cccc(CN)c3)=NN2)c1 |
| InChI | InChI=1S/C20H24N8O2/c21-9-13-3-1-5-15(7-13)11-23-19(29)17-25-27-18(28-26-17)20(30)24-12-16-6-2-4-14(8-16)10-22/h1-8H,9-12,21-22H2,(H,23,29)(H,24,30)(H,25,26)(H,27,28) |
| InChIKey | RSCYHIHXWXQQCU-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 159.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |