C12H14N6O3 — CID 59153878
methyl 6-[(4-aminophenyl)methylcarbamoyl]-1,4-dihydro-1,2,4,5-tetrazine-3-carboxylate (PubChem CID 59153878) has the molecular formula C12H14N6O3 and a molecular weight of 290.28 g/mol. Its IUPAC name is methyl 6-[(4-aminophenyl)methylcarbamoyl]-1,4-dihydro-1,2,4,5-tetrazine-3-carboxylate.
| Compound Name | methyl 6-[(4-aminophenyl)methylcarbamoyl]-1,4-dihydro-1,2,4,5-tetrazine-3-carboxylate |
|---|---|
| PubChem CID | 59153878 |
| Molecular Formula | C12H14N6O3 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | methyl 6-[(4-aminophenyl)methylcarbamoyl]-1,4-dihydro-1,2,4,5-tetrazine-3-carboxylate |
| SMILES | COC(=O)C1=NNC(C(=O)NCc2ccc(N)cc2)=NN1 |
| InChI | InChI=1S/C12H14N6O3/c1-21-12(20)10-17-15-9(16-18-10)11(19)14-6-7-2-4-8(13)5-3-7/h2-5H,6,13H2,1H3,(H,14,19)(H,15,16)(H,17,18) |
| InChIKey | PWUQFMUGCZSDFN-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 130.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|