C13H21N3O3 — CID 143901890
2-acetamido-N-[(4-aminophenyl)methyl]acetamide;methoxymethane (PubChem CID 143901890) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-acetamido-N-[(4-aminophenyl)methyl]acetamide;methoxymethane.
| Compound Name | 2-acetamido-N-[(4-aminophenyl)methyl]acetamide;methoxymethane |
|---|---|
| PubChem CID | 143901890 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 2-acetamido-N-[(4-aminophenyl)methyl]acetamide;methoxymethane |
| SMILES | CC(=O)NCC(=O)NCc1ccc(N)cc1.COC |
| InChI | InChI=1S/C11H15N3O2.C2H6O/c1-8(15)13-7-11(16)14-6-9-2-4-10(12)5-3-9;1-3-2/h2-5H,6-7,12H2,1H3,(H,13,15)(H,14,16);1-2H3 |
| InChIKey | PPZLAROCLHXZCF-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|