C14H16F3N3O3 — CID 60559844
2-acetamido-N-[2-oxo-2-[[4-(trifluoromethyl)phenyl]methylamino]ethyl]acetamide (PubChem CID 60559844) has the molecular formula C14H16F3N3O3 and a molecular weight of 331.29 g/mol. Its IUPAC name is 2-acetamido-N-[2-oxo-2-[[4-(trifluoromethyl)phenyl]methylamino]ethyl]acetamide.
| Compound Name | 2-acetamido-N-[2-oxo-2-[[4-(trifluoromethyl)phenyl]methylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 60559844 |
| Molecular Formula | C14H16F3N3O3 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 2-acetamido-N-[2-oxo-2-[[4-(trifluoromethyl)phenyl]methylamino]ethyl]acetamide |
| SMILES | CC(=O)NCC(=O)NCC(=O)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H16F3N3O3/c1-9(21)18-7-12(22)20-8-13(23)19-6-10-2-4-11(5-3-10)14(15,16)17/h2-5H,6-8H2,1H3,(H,18,21)(H,19,23)(H,20,22) |
| InChIKey | XBLMHFUFTMJOCI-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |