C18H17F3N2O4 — CID 146422502
4-hydroxy-3-methoxy-N-[2-oxo-2-[[4-(trifluoromethyl)phenyl]methylamino]ethyl]benzamide (PubChem CID 146422502) has the molecular formula C18H17F3N2O4 and a molecular weight of 382.34 g/mol. Its IUPAC name is 4-hydroxy-3-methoxy-N-[2-oxo-2-[[4-(trifluoromethyl)phenyl]methylamino]ethyl]benzamide.
| Compound Name | 4-hydroxy-3-methoxy-N-[2-oxo-2-[[4-(trifluoromethyl)phenyl]methylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 146422502 |
| Molecular Formula | C18H17F3N2O4 |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 4-hydroxy-3-methoxy-N-[2-oxo-2-[[4-(trifluoromethyl)phenyl]methylamino]ethyl]benzamide |
| SMILES | COc1cc(C(=O)NCC(=O)NCc2ccc(C(F)(F)F)cc2)ccc1O |
| InChI | InChI=1S/C18H17F3N2O4/c1-27-15-8-12(4-7-14(15)24)17(26)23-10-16(25)22-9-11-2-5-13(6-3-11)18(19,20)21/h2-8,24H,9-10H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | IPMGMDUUEFRBAA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |