C16H14F3N3O2 — CID 112993165
N-[2-oxo-2-(pyridin-4-ylmethylamino)ethyl]-4-(trifluoromethyl)benzamide (PubChem CID 112993165) has the molecular formula C16H14F3N3O2 and a molecular weight of 337.30 g/mol. Its IUPAC name is N-[2-oxo-2-(pyridin-4-ylmethylamino)ethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-oxo-2-(pyridin-4-ylmethylamino)ethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 112993165 |
| Molecular Formula | C16H14F3N3O2 |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | N-[2-oxo-2-(pyridin-4-ylmethylamino)ethyl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(CNC(=O)c1ccc(C(F)(F)F)cc1)NCc1ccncc1 |
| InChI | InChI=1S/C16H14F3N3O2/c17-16(18,19)13-3-1-12(2-4-13)15(24)22-10-14(23)21-9-11-5-7-20-8-6-11/h1-8H,9-10H2,(H,21,23)(H,22,24) |
| InChIKey | AHSWAZDFCDEZBA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |