C14H17F3N2O2 — CID 86976279
N-[2-(2-methylpropylamino)-2-oxoethyl]-4-(trifluoromethyl)benzamide (PubChem CID 86976279) has the molecular formula C14H17F3N2O2 and a molecular weight of 302.30 g/mol. Its IUPAC name is N-[2-(2-methylpropylamino)-2-oxoethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-(2-methylpropylamino)-2-oxoethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 86976279 |
| Molecular Formula | C14H17F3N2O2 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | N-[2-(2-methylpropylamino)-2-oxoethyl]-4-(trifluoromethyl)benzamide |
| SMILES | CC(C)CNC(=O)CNC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H17F3N2O2/c1-9(2)7-18-12(20)8-19-13(21)10-3-5-11(6-4-10)14(15,16)17/h3-6,9H,7-8H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | BJTSUWXHUIYGLB-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |