C17H14F4N2O2 — CID 27052452
4-fluoro-N-[2-oxo-2-[[4-(trifluoromethyl)phenyl]methylamino]ethyl]benzamide (PubChem CID 27052452) has the molecular formula C17H14F4N2O2 and a molecular weight of 354.30 g/mol. Its IUPAC name is 4-fluoro-N-[2-oxo-2-[[4-(trifluoromethyl)phenyl]methylamino]ethyl]benzamide.
| Compound Name | 4-fluoro-N-[2-oxo-2-[[4-(trifluoromethyl)phenyl]methylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 27052452 |
| Molecular Formula | C17H14F4N2O2 |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 4-fluoro-N-[2-oxo-2-[[4-(trifluoromethyl)phenyl]methylamino]ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(F)cc1)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H14F4N2O2/c18-14-7-3-12(4-8-14)16(25)23-10-15(24)22-9-11-1-5-13(6-2-11)17(19,20)21/h1-8H,9-10H2,(H,22,24)(H,23,25) |
| InChIKey | IUTRRYYWFSGMFT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |