C14H17F3N2O2 — CID 112990650
N-[2-(butylamino)-2-oxoethyl]-4-(trifluoromethyl)benzamide (PubChem CID 112990650) has the molecular formula C14H17F3N2O2 and a molecular weight of 302.30 g/mol. Its IUPAC name is N-[2-(butylamino)-2-oxoethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-(butylamino)-2-oxoethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 112990650 |
| Molecular Formula | C14H17F3N2O2 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | N-[2-(butylamino)-2-oxoethyl]-4-(trifluoromethyl)benzamide |
| SMILES | CCCCNC(=O)CNC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H17F3N2O2/c1-2-3-8-18-12(20)9-19-13(21)10-4-6-11(7-5-10)14(15,16)17/h4-7H,2-3,8-9H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | NNXDOGCERHAPKN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|