C22H26F3N3O2 — CID 142242776
N-[2-[3-[(3-ethylphenyl)methylamino]propylamino]-2-oxoethyl]-4-(trifluoromethyl)benzamide (PubChem CID 142242776) has the molecular formula C22H26F3N3O2 and a molecular weight of 421.46 g/mol. Its IUPAC name is N-[2-[3-[(3-ethylphenyl)methylamino]propylamino]-2-oxoethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[3-[(3-ethylphenyl)methylamino]propylamino]-2-oxoethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 142242776 |
| Molecular Formula | C22H26F3N3O2 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | N-[2-[3-[(3-ethylphenyl)methylamino]propylamino]-2-oxoethyl]-4-(trifluoromethyl)benzamide |
| SMILES | CCc1cccc(CNCCCNC(=O)CNC(=O)c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C22H26F3N3O2/c1-2-16-5-3-6-17(13-16)14-26-11-4-12-27-20(29)15-28-21(30)18-7-9-19(10-8-18)22(23,24)25/h3,5-10,13,26H,2,4,11-12,14-15H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | ZLEGTAORAQGOEI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|