C18H14F3N5O — CID 109259190
N-(pyridin-4-ylmethyl)-2-[4-(trifluoromethyl)anilino]pyrimidine-5-carboxamide (PubChem CID 109259190) has the molecular formula C18H14F3N5O and a molecular weight of 373.34 g/mol. Its IUPAC name is N-(pyridin-4-ylmethyl)-2-[4-(trifluoromethyl)anilino]pyrimidine-5-carboxamide.
| Compound Name | N-(pyridin-4-ylmethyl)-2-[4-(trifluoromethyl)anilino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109259190 |
| Molecular Formula | C18H14F3N5O |
| Molecular Weight | 373.34 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | N-(pyridin-4-ylmethyl)-2-[4-(trifluoromethyl)anilino]pyrimidine-5-carboxamide |
| SMILES | O=C(NCc1ccncc1)c1cnc(Nc2ccc(C(F)(F)F)cc2)nc1 |
| InChI | InChI=1S/C18H14F3N5O/c19-18(20,21)14-1-3-15(4-2-14)26-17-24-10-13(11-25-17)16(27)23-9-12-5-7-22-8-6-12/h1-8,10-11H,9H2,(H,23,27)(H,24,25,26) |
| InChIKey | RAPFLZLBROHZAR-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |