C16H13BrF3NO3 — CID 17478378
3-bromo-4-hydroxy-5-methoxy-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide (PubChem CID 17478378) has the molecular formula C16H13BrF3NO3 and a molecular weight of 404.18 g/mol. Its IUPAC name is 3-bromo-4-hydroxy-5-methoxy-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide.
| Compound Name | 3-bromo-4-hydroxy-5-methoxy-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 17478378 |
| Molecular Formula | C16H13BrF3NO3 |
| Molecular Weight | 404.18 g/mol |
| Exact Mass | 403.00 |
| IUPAC Name | 3-bromo-4-hydroxy-5-methoxy-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide |
| SMILES | COc1cc(C(=O)NCc2ccc(C(F)(F)F)cc2)cc(Br)c1O |
| InChI | InChI=1S/C16H13BrF3NO3/c1-24-13-7-10(6-12(17)14(13)22)15(23)21-8-9-2-4-11(5-3-9)16(18,19)20/h2-7,22H,8H2,1H3,(H,21,23) |
| InChIKey | MRHPYHKQGLRXLF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.18 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |