C16H17F3N2O — CID 162170581
2-methylpyridine;N-[[4-(trifluoromethyl)phenyl]methyl]acetamide (PubChem CID 162170581) has the molecular formula C16H17F3N2O and a molecular weight of 310.32 g/mol. Its IUPAC name is 2-methylpyridine;N-[[4-(trifluoromethyl)phenyl]methyl]acetamide.
| Compound Name | 2-methylpyridine;N-[[4-(trifluoromethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 162170581 |
| Molecular Formula | C16H17F3N2O |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 2-methylpyridine;N-[[4-(trifluoromethyl)phenyl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccc(C(F)(F)F)cc1.Cc1ccccn1 |
| InChI | InChI=1S/C10H10F3NO.C6H7N/c1-7(15)14-6-8-2-4-9(5-3-8)10(11,12)13;1-6-4-2-3-5-7-6/h2-5H,6H2,1H3,(H,14,15);2-5H,1H3 |
| InChIKey | ZNSQZWFRRDQGBV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |