C12H16F3NO — CID 144998983
ethane;N-[[4-(trifluoromethyl)phenyl]methyl]acetamide (PubChem CID 144998983) has the molecular formula C12H16F3NO and a molecular weight of 247.26 g/mol. Its IUPAC name is ethane;N-[[4-(trifluoromethyl)phenyl]methyl]acetamide.
| Compound Name | ethane;N-[[4-(trifluoromethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 144998983 |
| Molecular Formula | C12H16F3NO |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | ethane;N-[[4-(trifluoromethyl)phenyl]methyl]acetamide |
| SMILES | CC.CC(=O)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H10F3NO.C2H6/c1-7(15)14-6-8-2-4-9(5-3-8)10(11,12)13;1-2/h2-5H,6H2,1H3,(H,14,15);1-2H3 |
| InChIKey | UFLMJUYNIGQHFU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |