C17H15F3N2O3 — CID 17409636
N-[[4-[2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetyl]phenyl]methyl]acetamide (PubChem CID 17409636) has the molecular formula C17H15F3N2O3 and a molecular weight of 352.31 g/mol. Its IUPAC name is N-[[4-[2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetyl]phenyl]methyl]acetamide.
| Compound Name | N-[[4-[2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 17409636 |
| Molecular Formula | C17H15F3N2O3 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | N-[[4-[2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetyl]phenyl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccc(C(=O)Cn2cc(C(F)(F)F)ccc2=O)cc1 |
| InChI | InChI=1S/C17H15F3N2O3/c1-11(23)21-8-12-2-4-13(5-3-12)15(24)10-22-9-14(17(18,19)20)6-7-16(22)25/h2-7,9H,8,10H2,1H3,(H,21,23) |
| InChIKey | HCNBDGBMJLFAHH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |