C15H12F3NO3 — CID 1486027
methyl 4-[[2-oxo-5-(trifluoromethyl)-1-pyridinyl]methyl]benzoate (PubChem CID 1486027) has the molecular formula C15H12F3NO3 and a molecular weight of 311.26 g/mol. Its IUPAC name is methyl 4-[[2-oxo-5-(trifluoromethyl)-1-pyridinyl]methyl]benzoate.
| Compound Name | methyl 4-[[2-oxo-5-(trifluoromethyl)-1-pyridinyl]methyl]benzoate |
|---|---|
| PubChem CID | 1486027 |
| Molecular Formula | C15H12F3NO3 |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | methyl 4-[[2-oxo-5-(trifluoromethyl)-1-pyridinyl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(Cn2cc(C(F)(F)F)ccc2=O)cc1 |
| InChI | InChI=1S/C15H12F3NO3/c1-22-14(21)11-4-2-10(3-5-11)8-19-9-12(15(16,17)18)6-7-13(19)20/h2-7,9H,8H2,1H3 |
| InChIKey | FDLZTRVBLVKWPR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |