C14H11BrF3NO2 — CID 60673927
1-[(3-bromo-4-methoxyphenyl)methyl]-5-(trifluoromethyl)pyridin-2-one (PubChem CID 60673927) has the molecular formula C14H11BrF3NO2 and a molecular weight of 362.15 g/mol. Its IUPAC name is 1-[(3-bromo-4-methoxyphenyl)methyl]-5-(trifluoromethyl)pyridin-2-one.
| Compound Name | 1-[(3-bromo-4-methoxyphenyl)methyl]-5-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 60673927 |
| Molecular Formula | C14H11BrF3NO2 |
| Molecular Weight | 362.15 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | 1-[(3-bromo-4-methoxyphenyl)methyl]-5-(trifluoromethyl)pyridin-2-one |
| SMILES | COc1ccc(Cn2cc(C(F)(F)F)ccc2=O)cc1Br |
| InChI | InChI=1S/C14H11BrF3NO2/c1-21-12-4-2-9(6-11(12)15)7-19-8-10(14(16,17)18)3-5-13(19)20/h2-6,8H,7H2,1H3 |
| InChIKey | LJOQFDRNBKUCRB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.15 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |