C12H10BrFN2O3 — CID 3050978
1-[(3-bromo-4-methoxyphenyl)methyl]-5-fluoropyrimidine-2,4-dione (PubChem CID 3050978) has the molecular formula C12H10BrFN2O3 and a molecular weight of 329.13 g/mol. Its IUPAC name is 1-[(3-bromo-4-methoxyphenyl)methyl]-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-[(3-bromo-4-methoxyphenyl)methyl]-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3050978 |
| Molecular Formula | C12H10BrFN2O3 |
| Molecular Weight | 329.13 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | 1-[(3-bromo-4-methoxyphenyl)methyl]-5-fluoropyrimidine-2,4-dione |
| SMILES | COc1ccc(Cn2cc(F)c(=O)[nH]c2=O)cc1Br |
| InChI | InChI=1S/C12H10BrFN2O3/c1-19-10-3-2-7(4-8(10)13)5-16-6-9(14)11(17)15-12(16)18/h2-4,6H,5H2,1H3,(H,15,17,18) |
| InChIKey | NEHWINBFHWBREY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.13 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |