C11H7BrFN3O4 — CID 63811610
1-[(3-bromo-4-fluorophenyl)methyl]-5-nitropyrimidine-2,4-dione (PubChem CID 63811610) has the molecular formula C11H7BrFN3O4 and a molecular weight of 344.10 g/mol. Its IUPAC name is 1-[(3-bromo-4-fluorophenyl)methyl]-5-nitropyrimidine-2,4-dione.
| Compound Name | 1-[(3-bromo-4-fluorophenyl)methyl]-5-nitropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 63811610 |
| Molecular Formula | C11H7BrFN3O4 |
| Molecular Weight | 344.10 g/mol |
| Exact Mass | 342.96 |
| IUPAC Name | 1-[(3-bromo-4-fluorophenyl)methyl]-5-nitropyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(Cc2ccc(F)c(Br)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H7BrFN3O4/c12-7-3-6(1-2-8(7)13)4-15-5-9(16(19)20)10(17)14-11(15)18/h1-3,5H,4H2,(H,14,17,18) |
| InChIKey | LCTVTXDCKOHRFD-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.10 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|