C11H8FN3O4 — CID 91623257
5-fluoro-1-[(3-nitrophenyl)methyl]pyrimidine-2,4-dione (PubChem CID 91623257) has the molecular formula C11H8FN3O4 and a molecular weight of 265.20 g/mol. Its IUPAC name is 5-fluoro-1-[(3-nitrophenyl)methyl]pyrimidine-2,4-dione.
| Compound Name | 5-fluoro-1-[(3-nitrophenyl)methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 91623257 |
| Molecular Formula | C11H8FN3O4 |
| Molecular Weight | 265.20 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 5-fluoro-1-[(3-nitrophenyl)methyl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(Cc2cccc([N+](=O)[O-])c2)cc1F |
| InChI | InChI=1S/C11H8FN3O4/c12-9-6-14(11(17)13-10(9)16)5-7-2-1-3-8(4-7)15(18)19/h1-4,6H,5H2,(H,13,16,17) |
| InChIKey | CRHQUXNTEPRUTB-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.20 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|