C12H8N4O7 — CID 125114610
3,5-dinitro-1-[(3-nitrophenyl)methyl]pyridin-4-one (PubChem CID 125114610) has the molecular formula C12H8N4O7 and a molecular weight of 320.22 g/mol. Its IUPAC name is 3,5-dinitro-1-[(3-nitrophenyl)methyl]pyridin-4-one.
| Compound Name | 3,5-dinitro-1-[(3-nitrophenyl)methyl]pyridin-4-one |
|---|---|
| PubChem CID | 125114610 |
| Molecular Formula | C12H8N4O7 |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 3,5-dinitro-1-[(3-nitrophenyl)methyl]pyridin-4-one |
| SMILES | O=c1c([N+](=O)[O-])cn(Cc2cccc([N+](=O)[O-])c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H8N4O7/c17-12-10(15(20)21)6-13(7-11(12)16(22)23)5-8-2-1-3-9(4-8)14(18)19/h1-4,6-7H,5H2 |
| InChIKey | JSJPRDNPFGSJEN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 151.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|