C13H10N4O6 — CID 34349709
5-nitro-1-[(3-nitrophenyl)methyl]-2-oxopyridine-3-carboxamide (PubChem CID 34349709) has the molecular formula C13H10N4O6 and a molecular weight of 318.25 g/mol. Its IUPAC name is 5-nitro-1-[(3-nitrophenyl)methyl]-2-oxopyridine-3-carboxamide.
| Compound Name | 5-nitro-1-[(3-nitrophenyl)methyl]-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 34349709 |
| Molecular Formula | C13H10N4O6 |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 5-nitro-1-[(3-nitrophenyl)methyl]-2-oxopyridine-3-carboxamide |
| SMILES | NC(=O)c1cc([N+](=O)[O-])cn(Cc2cccc([N+](=O)[O-])c2)c1=O |
| InChI | InChI=1S/C13H10N4O6/c14-12(18)11-5-10(17(22)23)7-15(13(11)19)6-8-2-1-3-9(4-8)16(20)21/h1-5,7H,6H2,(H2,14,18) |
| InChIKey | OPMJCSYDBBIOKZ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 151.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|