C14H9FN4O5 — CID 71921248
1-[(5-fluoro-1,3-benzoxazol-2-yl)methyl]-5-nitro-2-oxopyridine-3-carboxamide (PubChem CID 71921248) has the molecular formula C14H9FN4O5 and a molecular weight of 332.25 g/mol. Its IUPAC name is 1-[(5-fluoro-1,3-benzoxazol-2-yl)methyl]-5-nitro-2-oxopyridine-3-carboxamide.
| Compound Name | 1-[(5-fluoro-1,3-benzoxazol-2-yl)methyl]-5-nitro-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 71921248 |
| Molecular Formula | C14H9FN4O5 |
| Molecular Weight | 332.25 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 1-[(5-fluoro-1,3-benzoxazol-2-yl)methyl]-5-nitro-2-oxopyridine-3-carboxamide |
| SMILES | NC(=O)c1cc([N+](=O)[O-])cn(Cc2nc3cc(F)ccc3o2)c1=O |
| InChI | InChI=1S/C14H9FN4O5/c15-7-1-2-11-10(3-7)17-12(24-11)6-18-5-8(19(22)23)4-9(13(16)20)14(18)21/h1-5H,6H2,(H2,16,20) |
| InChIKey | RPAYPYBZCHTNGS-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 134.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|