C13H9N3O4 — CID 38896135
1-(1,3-benzoxazol-2-ylmethyl)-5-nitropyridin-2-one (PubChem CID 38896135) has the molecular formula C13H9N3O4 and a molecular weight of 271.23 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-2-ylmethyl)-5-nitropyridin-2-one.
| Compound Name | 1-(1,3-benzoxazol-2-ylmethyl)-5-nitropyridin-2-one |
|---|---|
| PubChem CID | 38896135 |
| Molecular Formula | C13H9N3O4 |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 1-(1,3-benzoxazol-2-ylmethyl)-5-nitropyridin-2-one |
| SMILES | O=c1ccc([N+](=O)[O-])cn1Cc1nc2ccccc2o1 |
| InChI | InChI=1S/C13H9N3O4/c17-13-6-5-9(16(18)19)7-15(13)8-12-14-10-3-1-2-4-11(10)20-12/h1-7H,8H2 |
| InChIKey | OSBVHTWRYIDBLW-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 91.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|