C14H8N2O4 — CID 139215522
3-(4-nitrophenyl)-1,4-benzoxazin-2-one (PubChem CID 139215522) has the molecular formula C14H8N2O4 and a molecular weight of 268.23 g/mol. Its IUPAC name is 3-(4-nitrophenyl)-1,4-benzoxazin-2-one.
| Compound Name | 3-(4-nitrophenyl)-1,4-benzoxazin-2-one |
|---|---|
| PubChem CID | 139215522 |
| Molecular Formula | C14H8N2O4 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 3-(4-nitrophenyl)-1,4-benzoxazin-2-one |
| SMILES | O=c1oc2ccccc2nc1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H8N2O4/c17-14-13(9-5-7-10(8-6-9)16(18)19)15-11-3-1-2-4-12(11)20-14/h1-8H |
| InChIKey | JTTKNPCEQICRIY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 86.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|