C16H10N2O5 — CID 7068860
3-[2-(4-nitrophenyl)-2-oxoethyl]-1,4-benzoxazin-2-one (PubChem CID 7068860) has the molecular formula C16H10N2O5 and a molecular weight of 310.27 g/mol. Its IUPAC name is 3-[2-(4-nitrophenyl)-2-oxoethyl]-1,4-benzoxazin-2-one.
| Compound Name | 3-[2-(4-nitrophenyl)-2-oxoethyl]-1,4-benzoxazin-2-one |
|---|---|
| PubChem CID | 7068860 |
| Molecular Formula | C16H10N2O5 |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 3-[2-(4-nitrophenyl)-2-oxoethyl]-1,4-benzoxazin-2-one |
| SMILES | O=C(Cc1nc2ccccc2oc1=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H10N2O5/c19-14(10-5-7-11(8-6-10)18(21)22)9-13-16(20)23-15-4-2-1-3-12(15)17-13/h1-8H,9H2 |
| InChIKey | JOIRANMPKQFWPV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 103.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|