C16H10N2O5S — CID 8705629
(E)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-(4-nitrophenyl)prop-2-enoic acid (PubChem CID 8705629) has the molecular formula C16H10N2O5S and a molecular weight of 342.33 g/mol. Its IUPAC name is (E)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-(4-nitrophenyl)prop-2-enoic acid.
| Compound Name | (E)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-(4-nitrophenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 8705629 |
| Molecular Formula | C16H10N2O5S |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | (E)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-(4-nitrophenyl)prop-2-enoic acid |
| SMILES | O=C(O)/C(=C\c1ccc([N+](=O)[O-])cc1)Sc1nc2ccccc2o1 |
| InChI | InChI=1S/C16H10N2O5S/c19-15(20)14(9-10-5-7-11(8-6-10)18(21)22)24-16-17-12-3-1-2-4-13(12)23-16/h1-9H,(H,19,20)/b14-9+ |
| InChIKey | DVCFKYKLQZDWQZ-NTEUORMPSA-N |
| XLogP | 3.95 |
| TPSA | 106.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|