C21H12N2O4S — CID 124658012
(Z)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-[5-(2-cyanophenyl)furan-2-yl]prop-2-enoic acid (PubChem CID 124658012) has the molecular formula C21H12N2O4S and a molecular weight of 388.40 g/mol. Its IUPAC name is (Z)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-[5-(2-cyanophenyl)furan-2-yl]prop-2-enoic acid.
| Compound Name | (Z)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-[5-(2-cyanophenyl)furan-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 124658012 |
| Molecular Formula | C21H12N2O4S |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | (Z)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-[5-(2-cyanophenyl)furan-2-yl]prop-2-enoic acid |
| SMILES | N#Cc1ccccc1-c1ccc(/C=C(\Sc2nc3ccccc3o2)C(=O)O)o1 |
| InChI | InChI=1S/C21H12N2O4S/c22-12-13-5-1-2-6-15(13)17-10-9-14(26-17)11-19(20(24)25)28-21-23-16-7-3-4-8-18(16)27-21/h1-11H,(H,24,25)/b19-11- |
| InChIKey | VKIMQRRZSWFBMP-ODLFYWEKSA-N |
| XLogP | 5.18 |
| TPSA | 100.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|