C11H7NO5S — CID 70435645
(Z)-2-(1,3-benzoxazol-2-ylsulfanyl)but-2-enedioic acid (PubChem CID 70435645) has the molecular formula C11H7NO5S and a molecular weight of 265.25 g/mol. Its IUPAC name is (Z)-2-(1,3-benzoxazol-2-ylsulfanyl)but-2-enedioic acid.
| Compound Name | (Z)-2-(1,3-benzoxazol-2-ylsulfanyl)but-2-enedioic acid |
|---|---|
| PubChem CID | 70435645 |
| Molecular Formula | C11H7NO5S |
| Molecular Weight | 265.25 g/mol |
| Exact Mass | 265.00 |
| IUPAC Name | (Z)-2-(1,3-benzoxazol-2-ylsulfanyl)but-2-enedioic acid |
| SMILES | O=C(O)/C=C(\Sc1nc2ccccc2o1)C(=O)O |
| InChI | InChI=1S/C11H7NO5S/c13-9(14)5-8(10(15)16)18-11-12-6-3-1-2-4-7(6)17-11/h1-5H,(H,13,14)(H,15,16)/b8-5- |
| InChIKey | FUGUTUCLWULKLW-YVMONPNESA-N |
| XLogP | 1.97 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|