C21H13NO6S — CID 124657850
3-[5-[(Z)-2-(1,3-benzoxazol-2-ylsulfanyl)-2-carboxyethenyl]furan-2-yl]benzoic acid (PubChem CID 124657850) has the molecular formula C21H13NO6S and a molecular weight of 407.40 g/mol. Its IUPAC name is 3-[5-[(Z)-2-(1,3-benzoxazol-2-ylsulfanyl)-2-carboxyethenyl]furan-2-yl]benzoic acid.
| Compound Name | 3-[5-[(Z)-2-(1,3-benzoxazol-2-ylsulfanyl)-2-carboxyethenyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 124657850 |
| Molecular Formula | C21H13NO6S |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | 3-[5-[(Z)-2-(1,3-benzoxazol-2-ylsulfanyl)-2-carboxyethenyl]furan-2-yl]benzoic acid |
| SMILES | O=C(O)/C(=C/c1ccc(-c2cccc(C(=O)O)c2)o1)Sc1nc2ccccc2o1 |
| InChI | InChI=1S/C21H13NO6S/c23-19(24)13-5-3-4-12(10-13)16-9-8-14(27-16)11-18(20(25)26)29-21-22-15-6-1-2-7-17(15)28-21/h1-11H,(H,23,24)(H,25,26)/b18-11- |
| InChIKey | YZMDWMCIXLZIPY-WQRHYEAKSA-N |
| XLogP | 5.00 |
| TPSA | 113.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|