C18H15NO5S — CID 8705557
(Z)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-(2,5-dimethoxyphenyl)prop-2-enoic acid (PubChem CID 8705557) has the molecular formula C18H15NO5S and a molecular weight of 357.39 g/mol. Its IUPAC name is (Z)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-(2,5-dimethoxyphenyl)prop-2-enoic acid.
| Compound Name | (Z)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-(2,5-dimethoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 8705557 |
| Molecular Formula | C18H15NO5S |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | (Z)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-(2,5-dimethoxyphenyl)prop-2-enoic acid |
| SMILES | COc1ccc(OC)c(/C=C(\Sc2nc3ccccc3o2)C(=O)O)c1 |
| InChI | InChI=1S/C18H15NO5S/c1-22-12-7-8-14(23-2)11(9-12)10-16(17(20)21)25-18-19-13-5-3-4-6-15(13)24-18/h3-10H,1-2H3,(H,20,21)/b16-10- |
| InChIKey | COKBBYACBUMKEI-YBEGLDIGSA-N |
| XLogP | 4.06 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|