C15H11NO3S — CID 804062
S-(1,3-benzoxazol-2-yl) 4-methoxybenzenecarbothioate (PubChem CID 804062) has the molecular formula C15H11NO3S and a molecular weight of 285.32 g/mol. Its IUPAC name is S-(1,3-benzoxazol-2-yl) 4-methoxybenzenecarbothioate.
| Compound Name | S-(1,3-benzoxazol-2-yl) 4-methoxybenzenecarbothioate |
|---|---|
| PubChem CID | 804062 |
| Molecular Formula | C15H11NO3S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | S-(1,3-benzoxazol-2-yl) 4-methoxybenzenecarbothioate |
| SMILES | COc1ccc(C(=O)Sc2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C15H11NO3S/c1-18-11-8-6-10(7-9-11)14(17)20-15-16-12-4-2-3-5-13(12)19-15/h2-9H,1H3 |
| InChIKey | GQQPWAVBSMTGCZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|