C16H14N2O3 — CID 110711644
N-(1,3-benzoxazol-2-ylmethyl)-4-methoxybenzamide (PubChem CID 110711644) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is N-(1,3-benzoxazol-2-ylmethyl)-4-methoxybenzamide.
| Compound Name | N-(1,3-benzoxazol-2-ylmethyl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 110711644 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | N-(1,3-benzoxazol-2-ylmethyl)-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NCc2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C16H14N2O3/c1-20-12-8-6-11(7-9-12)16(19)17-10-15-18-13-4-2-3-5-14(13)21-15/h2-9H,10H2,1H3,(H,17,19) |
| InChIKey | ZWCXQRYDLDSCHN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |