C20H22N2O3 — CID 9049434
N-[(1R)-1-(1,3-benzoxazol-2-yl)-3-methylbutyl]-4-methoxybenzamide (PubChem CID 9049434) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is N-[(1R)-1-(1,3-benzoxazol-2-yl)-3-methylbutyl]-4-methoxybenzamide.
| Compound Name | N-[(1R)-1-(1,3-benzoxazol-2-yl)-3-methylbutyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 9049434 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | N-[(1R)-1-(1,3-benzoxazol-2-yl)-3-methylbutyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N[C@H](CC(C)C)c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C20H22N2O3/c1-13(2)12-17(20-22-16-6-4-5-7-18(16)25-20)21-19(23)14-8-10-15(24-3)11-9-14/h4-11,13,17H,12H2,1-3H3,(H,21,23)/t17-/m1/s1 |
| InChIKey | ZCZKAOOAWFZVAF-QGZVFWFLSA-N |
| XLogP | 4.35 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |