C21H24N2O4 — CID 9049529
N-[(1R)-1-(1,3-benzoxazol-2-yl)-3-methylbutyl]-3,5-dimethoxybenzamide (PubChem CID 9049529) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is N-[(1R)-1-(1,3-benzoxazol-2-yl)-3-methylbutyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[(1R)-1-(1,3-benzoxazol-2-yl)-3-methylbutyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 9049529 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | N-[(1R)-1-(1,3-benzoxazol-2-yl)-3-methylbutyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)N[C@H](CC(C)C)c2nc3ccccc3o2)c1 |
| InChI | InChI=1S/C21H24N2O4/c1-13(2)9-18(21-23-17-7-5-6-8-19(17)27-21)22-20(24)14-10-15(25-3)12-16(11-14)26-4/h5-8,10-13,18H,9H2,1-4H3,(H,22,24)/t18-/m1/s1 |
| InChIKey | KDDYBKIYDDRLCT-GOSISDBHSA-N |
| XLogP | 4.36 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |