C19H20N2O4 — CID 46424516
3,5-dimethoxy-N-(2-propan-2-yl-1,3-benzoxazol-5-yl)benzamide (PubChem CID 46424516) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 3,5-dimethoxy-N-(2-propan-2-yl-1,3-benzoxazol-5-yl)benzamide.
| Compound Name | 3,5-dimethoxy-N-(2-propan-2-yl-1,3-benzoxazol-5-yl)benzamide |
|---|---|
| PubChem CID | 46424516 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 3,5-dimethoxy-N-(2-propan-2-yl-1,3-benzoxazol-5-yl)benzamide |
| SMILES | COc1cc(OC)cc(C(=O)Nc2ccc3oc(C(C)C)nc3c2)c1 |
| InChI | InChI=1S/C19H20N2O4/c1-11(2)19-21-16-9-13(5-6-17(16)25-19)20-18(22)12-7-14(23-3)10-15(8-12)24-4/h5-11H,1-4H3,(H,20,22) |
| InChIKey | QMWDHPBUXCQDMT-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |