C22H17FN2O4 — CID 1015782
N-[2-(2-fluorophenyl)-1,3-benzoxazol-5-yl]-3,5-dimethoxybenzamide (PubChem CID 1015782) has the molecular formula C22H17FN2O4 and a molecular weight of 392.39 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)-1,3-benzoxazol-5-yl]-3,5-dimethoxybenzamide.
| Compound Name | N-[2-(2-fluorophenyl)-1,3-benzoxazol-5-yl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 1015782 |
| Molecular Formula | C22H17FN2O4 |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | N-[2-(2-fluorophenyl)-1,3-benzoxazol-5-yl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)Nc2ccc3oc(-c4ccccc4F)nc3c2)c1 |
| InChI | InChI=1S/C22H17FN2O4/c1-27-15-9-13(10-16(12-15)28-2)21(26)24-14-7-8-20-19(11-14)25-22(29-20)17-5-3-4-6-18(17)23/h3-12H,1-2H3,(H,24,26) |
| InChIKey | NTJSGVFQTAEXER-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |