C22H16ClFN2O3 — CID 5346346
3-chloro-4-ethoxy-N-[2-(2-fluorophenyl)-1,3-benzoxazol-5-yl]benzamide (PubChem CID 5346346) has the molecular formula C22H16ClFN2O3 and a molecular weight of 410.83 g/mol. Its IUPAC name is 3-chloro-4-ethoxy-N-[2-(2-fluorophenyl)-1,3-benzoxazol-5-yl]benzamide.
| Compound Name | 3-chloro-4-ethoxy-N-[2-(2-fluorophenyl)-1,3-benzoxazol-5-yl]benzamide |
|---|---|
| PubChem CID | 5346346 |
| Molecular Formula | C22H16ClFN2O3 |
| Molecular Weight | 410.83 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 3-chloro-4-ethoxy-N-[2-(2-fluorophenyl)-1,3-benzoxazol-5-yl]benzamide |
| SMILES | CCOc1ccc(C(=O)Nc2ccc3oc(-c4ccccc4F)nc3c2)cc1Cl |
| InChI | InChI=1S/C22H16ClFN2O3/c1-2-28-19-9-7-13(11-16(19)23)21(27)25-14-8-10-20-18(12-14)26-22(29-20)15-5-3-4-6-17(15)24/h3-12H,2H2,1H3,(H,25,27) |
| InChIKey | QGJKTVSDPOSAIX-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.83 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |