C22H21N3O4 — CID 9049482
N-[(1S)-1-(1,3-benzoxazol-2-yl)-3-methylbutyl]-2-(1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 9049482) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is N-[(1S)-1-(1,3-benzoxazol-2-yl)-3-methylbutyl]-2-(1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-[(1S)-1-(1,3-benzoxazol-2-yl)-3-methylbutyl]-2-(1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 9049482 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | N-[(1S)-1-(1,3-benzoxazol-2-yl)-3-methylbutyl]-2-(1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | CC(C)C[C@H](NC(=O)CN1C(=O)c2ccccc2C1=O)c1nc2ccccc2o1 |
| InChI | InChI=1S/C22H21N3O4/c1-13(2)11-17(20-24-16-9-5-6-10-18(16)29-20)23-19(26)12-25-21(27)14-7-3-4-8-15(14)22(25)28/h3-10,13,17H,11-12H2,1-2H3,(H,23,26)/t17-/m0/s1 |
| InChIKey | RYXUUKXHCXWZTA-KRWDZBQOSA-N |
| XLogP | 3.33 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|