C22H24N2O3 — CID 55690067
N-(3,3-dimethyl-1-phenylbutyl)-2-(1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 55690067) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is N-(3,3-dimethyl-1-phenylbutyl)-2-(1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-(3,3-dimethyl-1-phenylbutyl)-2-(1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 55690067 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | N-(3,3-dimethyl-1-phenylbutyl)-2-(1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | CC(C)(C)CC(NC(=O)CN1C(=O)c2ccccc2C1=O)c1ccccc1 |
| InChI | InChI=1S/C22H24N2O3/c1-22(2,3)13-18(15-9-5-4-6-10-15)23-19(25)14-24-20(26)16-11-7-8-12-17(16)21(24)27/h4-12,18H,13-14H2,1-3H3,(H,23,25) |
| InChIKey | IVGFCFVWESWFRV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|