C21H23N3O3 — CID 8936932
N-[(1R)-2-(dimethylamino)-1-phenylethyl]-3-(1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 8936932) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is N-[(1R)-2-(dimethylamino)-1-phenylethyl]-3-(1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-[(1R)-2-(dimethylamino)-1-phenylethyl]-3-(1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 8936932 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | N-[(1R)-2-(dimethylamino)-1-phenylethyl]-3-(1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | CN(C)C[C@H](NC(=O)CCN1C(=O)c2ccccc2C1=O)c1ccccc1 |
| InChI | InChI=1S/C21H23N3O3/c1-23(2)14-18(15-8-4-3-5-9-15)22-19(25)12-13-24-20(26)16-10-6-7-11-17(16)21(24)27/h3-11,18H,12-14H2,1-2H3,(H,22,25)/t18-/m0/s1 |
| InChIKey | CTHIXUZCQIZBOT-SFHVURJKSA-N |
| XLogP | 2.09 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|