C19H20N2O3 — CID 110711828
N-[2-(1,3-benzoxazol-2-yl)ethyl]-3-(4-methoxyphenyl)propanamide (PubChem CID 110711828) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is N-[2-(1,3-benzoxazol-2-yl)ethyl]-3-(4-methoxyphenyl)propanamide.
| Compound Name | N-[2-(1,3-benzoxazol-2-yl)ethyl]-3-(4-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 110711828 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | N-[2-(1,3-benzoxazol-2-yl)ethyl]-3-(4-methoxyphenyl)propanamide |
| SMILES | COc1ccc(CCC(=O)NCCc2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C19H20N2O3/c1-23-15-9-6-14(7-10-15)8-11-18(22)20-13-12-19-21-16-4-2-3-5-17(16)24-19/h2-7,9-10H,8,11-13H2,1H3,(H,20,22) |
| InChIKey | CXTGMAYIODRHAY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |