C23H28N2O3 — CID 39278562
4-(1,3-benzoxazol-2-yl)-N-[2-(4-tert-butylphenoxy)ethyl]butanamide (PubChem CID 39278562) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-2-yl)-N-[2-(4-tert-butylphenoxy)ethyl]butanamide.
| Compound Name | 4-(1,3-benzoxazol-2-yl)-N-[2-(4-tert-butylphenoxy)ethyl]butanamide |
|---|---|
| PubChem CID | 39278562 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 4-(1,3-benzoxazol-2-yl)-N-[2-(4-tert-butylphenoxy)ethyl]butanamide |
| SMILES | CC(C)(C)c1ccc(OCCNC(=O)CCCc2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C23H28N2O3/c1-23(2,3)17-11-13-18(14-12-17)27-16-15-24-21(26)9-6-10-22-25-19-7-4-5-8-20(19)28-22/h4-5,7-8,11-14H,6,9-10,15-16H2,1-3H3,(H,24,26) |
| InChIKey | KCULXSFQYJIBTK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|